Table 3 Comparison of the performance of the current catalyst with several other catalysts in synthesis 2-amino-4,6-diphenylnicotinonitrile derivatives.
Entry | Reaction conditions | Time (min) | Yield (%) | Lit |
|---|---|---|---|---|
1 | Yb(PFO)3 (2.5 mol%), EtOH, reflux | 240 | 90 | |
2 | Nano Fe3O4 (30 mg), solvent‐free, 80 °C | 120 | 90 | |
3 | CoFe2O4@TRIS@ sulfated boric acid (5 mg), Solvent-free, 90 °C | 35 | 90 | |
4 | Cu@imineZCMNPs, solvent-free, 80 °C | 18 | 92 | |
5 | Bu4N+Br− (10 mol%), H2O, reflux | 120 | 92 | |
6 | GO (10), H2O, 80 °C | 350 | 96 | |
7 | Fe3O4@TiO2@O2PO2(CH2)NHSO3H, solvent‐free, 90 °C | 20 | 90 | |
8 | Mn@PMO-IL nanocatalyst, solvent free, 80 °C | 15–100 | 55–95 | |
9 | Cellulose–SO3H (0.05 mmol), water, 60 °C | 150 | 96 | |
10 | LDH@TRMS@NH2SO2(C2H4)SO2NH2@nano copper, solvent‐free, 60 °C | 8 | 92 | This work |