Table 9 Summary of mineralogical composition of the as-received red mud and the red mud collected after experiment 3 based on XRD analysis.
Mineral | Chemical formula | Concentration in solid (wt%) | |
|---|---|---|---|
Raw RM | Experiment 3 | ||
Hematite | Fe2O3 | 25.6 | 22.5 |
Cancrinite | Na6(Al6Si6O24)(CaCO3)(H2O)2 | 0.30 | 0.00 |
Chantalite | CaAl2SiO4(OH)4 | 24.2 | 15.4 |
Magnesite | MgCO3 | 4.70 | 12.6 |
Calcite | CaCO3 | 7.60 | 6.1 |
Rutile | TiO2 | 22.8 | 24.3 |
Gibbsite | Al(OH)3 | 6.30 | 8.6 |
Boehmite | Al2O3·H2O | 8.40 | 9.6 |
Sodalite | Na8(Al6Si 6O24)Cl2 | 0.00 | 0.70 |
Anatase | TiO2 | 0.00 | 0.20 |
Gypsum | CaSO4·2H2O, | 0.00 | 0.00 |